Benzene and substituted derivatives
Filtered Search Results
Polyanetholesulfonic Acid Sodium Salt, Reagent Grade, MP Biomedicals™
CAS: 52993-95-0 Molecular Formula: (C10H11O4SNa)n MDL Number: MFCD00148427 Synonym: sodium anethole,benzenesulfonic acid, methoxypropenyl-, sodium salt, homopolymer,sodium methoxypropenylbenzenesulonate homopolymer,benzenesulfonic acid, methoxy 1-propenyl-, sodium salt, homopolymer,sodium 1-methoxy-4-e-prop-1-enyl benzene,benzenesulfonic acid, methoxy 1-propen-1-yl-, sodium salt 1:1 , homopolymer
| CAS | 52993-95-0 |
|---|---|
| MDL Number | MFCD00148427 |
| Synonym | sodium anethole,benzenesulfonic acid, methoxypropenyl-, sodium salt, homopolymer,sodium methoxypropenylbenzenesulonate homopolymer,benzenesulfonic acid, methoxy 1-propenyl-, sodium salt, homopolymer,sodium 1-methoxy-4-e-prop-1-enyl benzene,benzenesulfonic acid, methoxy 1-propen-1-yl-, sodium salt 1:1 , homopolymer |
| Molecular Formula | (C10H11O4SNa)n |
Polystyrene, atactic
CAS: 9003-53-6 Molecular Formula: (C8H8)n Molecular Weight (g/mol): 104.15 MDL Number: MFCD00084450 InChI Key: PPBRXRYQALVLMV-UHFFFAOYSA-N Synonym: ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene PubChem CID: 7501 ChEBI: CHEBI:27452 IUPAC Name: styrene SMILES: *-CC(-*)C1=CC=CC=C1
| PubChem CID | 7501 |
|---|---|
| CAS | 9003-53-6 |
| Molecular Weight (g/mol) | 104.15 |
| ChEBI | CHEBI:27452 |
| MDL Number | MFCD00084450 |
| SMILES | *-CC(-*)C1=CC=CC=C1 |
| Synonym | ethenylbenzene,phenylethylene,vinylbenzene,styrol,benzene, ethenyl,cinnamene,phenylethene,monomer,phenethylene,styrolene |
| IUPAC Name | styrene |
| InChI Key | PPBRXRYQALVLMV-UHFFFAOYSA-N |
| Molecular Formula | (C8H8)n |
trans-2-(4-chlorophenyl)vinylboronic acid, 97%
CAS: 154230-29-2 Molecular Formula: C8H8BClO2 Molecular Weight (g/mol): 182.41 MDL Number: MFCD02093767 InChI Key: HWSDRAPTZRYXHN-AATRIKPKSA-N Synonym: trans-2-4-chlorophenyl vinylboronic acid,4-chlorostyryl boronic acid,e-2-4-chlorophenyl ethenyl boronic acid,e-4-chlorostyrylboronic acid,boronic acid, 1e-2-4-chlorophenyl ethenyl,e-2-4-chlorophenyl ethenylboronic acid,trans-2-4-chlorophenyl ethenylboronic acid,rarechem al ba 0169,e-2-4-chlorophenyl vinyl boronic acid,4-chlorostyrylboronic acid PubChem CID: 642694 IUPAC Name: [(E)-2-(4-chlorophenyl)ethenyl]boronic acid SMILES: OB(O)\C=C\C1=CC=C(Cl)C=C1
| PubChem CID | 642694 |
|---|---|
| CAS | 154230-29-2 |
| Molecular Weight (g/mol) | 182.41 |
| MDL Number | MFCD02093767 |
| SMILES | OB(O)\C=C\C1=CC=C(Cl)C=C1 |
| Synonym | trans-2-4-chlorophenyl vinylboronic acid,4-chlorostyryl boronic acid,e-2-4-chlorophenyl ethenyl boronic acid,e-4-chlorostyrylboronic acid,boronic acid, 1e-2-4-chlorophenyl ethenyl,e-2-4-chlorophenyl ethenylboronic acid,trans-2-4-chlorophenyl ethenylboronic acid,rarechem al ba 0169,e-2-4-chlorophenyl vinyl boronic acid,4-chlorostyrylboronic acid |
| IUPAC Name | [(E)-2-(4-chlorophenyl)ethenyl]boronic acid |
| InChI Key | HWSDRAPTZRYXHN-AATRIKPKSA-N |
| Molecular Formula | C8H8BClO2 |
trans,trans-Dibenzylideneacetone, 98+%
CAS: 35225-79-7 Molecular Formula: C17H14O Molecular Weight (g/mol): 234.30 MDL Number: MFCD00004790 InChI Key: WMKGGPCROCCUDY-PHEQNACWSA-N Synonym: dibenzylideneacetone,1,5-diphenylpenta-1,4-dien-3-one,trans,trans-dibenzylideneacetone,dibenzalacetone,1e,4e-1,5-diphenylpenta-1,4-dien-3-one,dibenzylidene acetone,distyryl ketone,1,5-diphenyl-1,4-pentadien-3-one,trans,trans-dibenzalacetone,trans,trans-1,5-diphenyl-1,4-pentadien-3-one PubChem CID: 640180 IUPAC Name: (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one SMILES: O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1
| PubChem CID | 640180 |
|---|---|
| CAS | 35225-79-7 |
| Molecular Weight (g/mol) | 234.30 |
| MDL Number | MFCD00004790 |
| SMILES | O=C(\C=C\C1=CC=CC=C1)/C=C/C1=CC=CC=C1 |
| Synonym | dibenzylideneacetone,1,5-diphenylpenta-1,4-dien-3-one,trans,trans-dibenzylideneacetone,dibenzalacetone,1e,4e-1,5-diphenylpenta-1,4-dien-3-one,dibenzylidene acetone,distyryl ketone,1,5-diphenyl-1,4-pentadien-3-one,trans,trans-dibenzalacetone,trans,trans-1,5-diphenyl-1,4-pentadien-3-one |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-one |
| InChI Key | WMKGGPCROCCUDY-PHEQNACWSA-N |
| Molecular Formula | C17H14O |
trans-beta-Nitrostyrene, 97+%
CAS: 5153-67-3 Molecular Formula: C8H7NO2 Molecular Weight (g/mol): 149.15 MDL Number: MFCD00007402 InChI Key: PIAOLBVUVDXHHL-VOTSOKGWSA-N Synonym: trans-beta-nitrostyrene,2-nitrovinyl benzene,e-2-nitrovinyl benzene,beta-nitrostyrene,2-nitro-1-phenylethylene,e-beta-nitrostyrene,2-nitroethenyl benzene,1-phenyl-2-nitroethene,beta-nitrosytrene,benzene, 2-nitroethenyl PubChem CID: 5284459 IUPAC Name: [(E)-2-nitroethenyl]benzene SMILES: [O-][N+](=O)\C=C\C1=CC=CC=C1
| PubChem CID | 5284459 |
|---|---|
| CAS | 5153-67-3 |
| Molecular Weight (g/mol) | 149.15 |
| MDL Number | MFCD00007402 |
| SMILES | [O-][N+](=O)\C=C\C1=CC=CC=C1 |
| Synonym | trans-beta-nitrostyrene,2-nitrovinyl benzene,e-2-nitrovinyl benzene,beta-nitrostyrene,2-nitro-1-phenylethylene,e-beta-nitrostyrene,2-nitroethenyl benzene,1-phenyl-2-nitroethene,beta-nitrosytrene,benzene, 2-nitroethenyl |
| IUPAC Name | [(E)-2-nitroethenyl]benzene |
| InChI Key | PIAOLBVUVDXHHL-VOTSOKGWSA-N |
| Molecular Formula | C8H7NO2 |
3-Bromostyrene, 97%, stabilized
CAS: 2039-86-3 Molecular Formula: C8H7Br Molecular Weight (g/mol): 183.05 InChI Key: KQJQPCJDKBKSLV-UHFFFAOYSA-N Synonym: 3-bromostyrene,1-bromo-3-vinylbenzene,m-bromostyrene,benzene, 1-bromo-3-ethenyl,1-bromo-3-vinyl-benzene,unii-6xe3sf241y,3-bromo-styrene,pubchem23859,acmc-1cmdc,1-bromo-3-vinylbenzene # PubChem CID: 74870 IUPAC Name: 1-bromo-3-ethenylbenzene SMILES: C=CC1=CC(=CC=C1)Br
| PubChem CID | 74870 |
|---|---|
| CAS | 2039-86-3 |
| Molecular Weight (g/mol) | 183.05 |
| SMILES | C=CC1=CC(=CC=C1)Br |
| Synonym | 3-bromostyrene,1-bromo-3-vinylbenzene,m-bromostyrene,benzene, 1-bromo-3-ethenyl,1-bromo-3-vinyl-benzene,unii-6xe3sf241y,3-bromo-styrene,pubchem23859,acmc-1cmdc,1-bromo-3-vinylbenzene # |
| IUPAC Name | 1-bromo-3-ethenylbenzene |
| InChI Key | KQJQPCJDKBKSLV-UHFFFAOYSA-N |
| Molecular Formula | C8H7Br |
Cinnamonitrile, 97%, predominantly trans
CAS: 1885-38-7 Molecular Formula: C9H7N Molecular Weight (g/mol): 129.16 MDL Number: MFCD00001930 InChI Key: ZWKNLRXFUTWSOY-QPJJXVBHSA-N Synonym: cinnamonitrile,trans-cinnamonitrile,styryl cyanide,cinnamyl nitrile,3-phenylacrylonitrile,beta-cyanostyrene,cinnamonitrile, e,3-phenyl-2-propenenitrile,acrylonitrile, 3-phenyl,e-3-phenylprop-2-enenitrile PubChem CID: 1550846 IUPAC Name: (E)-3-phenylprop-2-enenitrile SMILES: C1=CC=C(C=C1)C=CC#N
| PubChem CID | 1550846 |
|---|---|
| CAS | 1885-38-7 |
| Molecular Weight (g/mol) | 129.16 |
| MDL Number | MFCD00001930 |
| SMILES | C1=CC=C(C=C1)C=CC#N |
| Synonym | cinnamonitrile,trans-cinnamonitrile,styryl cyanide,cinnamyl nitrile,3-phenylacrylonitrile,beta-cyanostyrene,cinnamonitrile, e,3-phenyl-2-propenenitrile,acrylonitrile, 3-phenyl,e-3-phenylprop-2-enenitrile |
| IUPAC Name | (E)-3-phenylprop-2-enenitrile |
| InChI Key | ZWKNLRXFUTWSOY-QPJJXVBHSA-N |
| Molecular Formula | C9H7N |
4,4'-cis-Stilbenedicarboxylic acid, 95%
CAS: 133005-88-6 Molecular Formula: C16H12O4 Molecular Weight (g/mol): 268.268 MDL Number: MFCD00013994 InChI Key: SBBQDUFLZGOASY-UPHRSURJSA-N Synonym: 4-z-2-4-carboxyphenyl ethenyl benzoic acid,cis-stilbene-4,4'-dicarboxylic acid,z-4,4'-ethene-1,2-diyl dibenzoic acid,cis-4,4'-dicarboxystilbene,z-4,4'-stilbene dicarboxylic acid,z-stilbene-4,4'-dicarboxylic acid,4,4'-cis-stilbenedicarboxylic acid PubChem CID: 18647961 IUPAC Name: 4-[(Z)-2-(4-carboxyphenyl)ethenyl]benzoic acid SMILES: C1=CC(=CC=C1C=CC2=CC=C(C=C2)C(=O)O)C(=O)O
| PubChem CID | 18647961 |
|---|---|
| CAS | 133005-88-6 |
| Molecular Weight (g/mol) | 268.268 |
| MDL Number | MFCD00013994 |
| SMILES | C1=CC(=CC=C1C=CC2=CC=C(C=C2)C(=O)O)C(=O)O |
| Synonym | 4-z-2-4-carboxyphenyl ethenyl benzoic acid,cis-stilbene-4,4'-dicarboxylic acid,z-4,4'-ethene-1,2-diyl dibenzoic acid,cis-4,4'-dicarboxystilbene,z-4,4'-stilbene dicarboxylic acid,z-stilbene-4,4'-dicarboxylic acid,4,4'-cis-stilbenedicarboxylic acid |
| IUPAC Name | 4-[(Z)-2-(4-carboxyphenyl)ethenyl]benzoic acid |
| InChI Key | SBBQDUFLZGOASY-UPHRSURJSA-N |
| Molecular Formula | C16H12O4 |
4-Vinylbenzoic acid, 96%
CAS: 1075-49-6 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.16 MDL Number: MFCD00002569 InChI Key: IRQWEODKXLDORP-UHFFFAOYSA-N Synonym: 4-vinylbenzoic acid,p-vinylbenzoic acid,4-carboxystyrene,benzoic acid, 4-ethenyl,styrene-4-carboxylic acid,4-vinyl-benzoic acid,p-vinyl benzoic acid,4-vinyl benzoic acid,para-vinyl benzoic acid,pubchem12624 PubChem CID: 14098 IUPAC Name: 4-ethenylbenzoic acid SMILES: C=CC1=CC=C(C=C1)C(=O)O
| PubChem CID | 14098 |
|---|---|
| CAS | 1075-49-6 |
| Molecular Weight (g/mol) | 148.16 |
| MDL Number | MFCD00002569 |
| SMILES | C=CC1=CC=C(C=C1)C(=O)O |
| Synonym | 4-vinylbenzoic acid,p-vinylbenzoic acid,4-carboxystyrene,benzoic acid, 4-ethenyl,styrene-4-carboxylic acid,4-vinyl-benzoic acid,p-vinyl benzoic acid,4-vinyl benzoic acid,para-vinyl benzoic acid,pubchem12624 |
| IUPAC Name | 4-ethenylbenzoic acid |
| InChI Key | IRQWEODKXLDORP-UHFFFAOYSA-N |
| Molecular Formula | C9H8O2 |
Cinnamoyl chloride, 98%, predominantly trans
CAS: 102-92-1 Molecular Formula: C9H7ClO Molecular Weight (g/mol): 166.61 MDL Number: MFCD00000732 InChI Key: WOGITNXCNOTRLK-VOTSOKGWSA-N Synonym: cinnamoyl chloride,cinnamic acid chloride,cinnamic chloride,trans-3-phenylacryloyl chloride,2-propenoyl chloride, 3-phenyl,cinnamoylchloride,e-cinnamoyl chloride,trans-cinnamoyl chloride,2e-3-phenylprop-2-enoyl chloride,3-phenyl-2-propenoyl chloride PubChem CID: 5354261 IUPAC Name: (E)-3-phenylprop-2-enoyl chloride SMILES: C1=CC=C(C=C1)C=CC(=O)Cl
| PubChem CID | 5354261 |
|---|---|
| CAS | 102-92-1 |
| Molecular Weight (g/mol) | 166.61 |
| MDL Number | MFCD00000732 |
| SMILES | C1=CC=C(C=C1)C=CC(=O)Cl |
| Synonym | cinnamoyl chloride,cinnamic acid chloride,cinnamic chloride,trans-3-phenylacryloyl chloride,2-propenoyl chloride, 3-phenyl,cinnamoylchloride,e-cinnamoyl chloride,trans-cinnamoyl chloride,2e-3-phenylprop-2-enoyl chloride,3-phenyl-2-propenoyl chloride |
| IUPAC Name | (E)-3-phenylprop-2-enoyl chloride |
| InChI Key | WOGITNXCNOTRLK-VOTSOKGWSA-N |
| Molecular Formula | C9H7ClO |
5-Phenyl-2,4-pentadienoic acid, 98+%
CAS: 1552-94-9 Molecular Formula: C11H10O2 Molecular Weight (g/mol): 174.199 MDL Number: MFCD00014018 InChI Key: FEIQOMCWGDNMHM-KBXRYBNXSA-N Synonym: 5-phenylpenta-2,4-dienoic acid,2e,4e-5-phenylpenta-2,4-dienoic acid,5-phenyl-2,4-pentadienoic acid,2,4-pentadienoic acid, 5-phenyl,e,e-cinnamylideneacetic acid,2e,4e-5-phenyl-2,4-pentadienoic acid,2,4-pentadienoicacid, 5-phenyl-, 2e,4e,4-phenyl-1,3-butadiene-1-carboxylic acid,juarezic acid,cinnamylidene acetic acid PubChem CID: 1549512 IUPAC Name: (2E,4E)-5-phenylpenta-2,4-dienoic acid SMILES: C1=CC=C(C=C1)C=CC=CC(=O)O
| PubChem CID | 1549512 |
|---|---|
| CAS | 1552-94-9 |
| Molecular Weight (g/mol) | 174.199 |
| MDL Number | MFCD00014018 |
| SMILES | C1=CC=C(C=C1)C=CC=CC(=O)O |
| Synonym | 5-phenylpenta-2,4-dienoic acid,2e,4e-5-phenylpenta-2,4-dienoic acid,5-phenyl-2,4-pentadienoic acid,2,4-pentadienoic acid, 5-phenyl,e,e-cinnamylideneacetic acid,2e,4e-5-phenyl-2,4-pentadienoic acid,2,4-pentadienoicacid, 5-phenyl-, 2e,4e,4-phenyl-1,3-butadiene-1-carboxylic acid,juarezic acid,cinnamylidene acetic acid |
| IUPAC Name | (2E,4E)-5-phenylpenta-2,4-dienoic acid |
| InChI Key | FEIQOMCWGDNMHM-KBXRYBNXSA-N |
| Molecular Formula | C11H10O2 |
2-Methylstyrene, 98%, stab. with 0.1% 4-tert-butylcatechol
CAS: 611-15-4 Molecular Formula: C9H10 Molecular Weight (g/mol): 118.179 MDL Number: MFCD00014936 InChI Key: NVZWEEGUWXZOKI-UHFFFAOYSA-N Synonym: 2-methylstyrene,2-vinyltoluene,o-vinyltoluene,o-methylstyrene,styrene, o-methyl,1-methyl-2-vinylbenzene,benzene, 1-ethenyl-2-methyl,ortho-methylstyrene,unii-556uo5cl44,1-ethenyl-2-methyl-benzene PubChem CID: 11904 IUPAC Name: 1-ethenyl-2-methylbenzene SMILES: CC1=CC=CC=C1C=C
| PubChem CID | 11904 |
|---|---|
| CAS | 611-15-4 |
| Molecular Weight (g/mol) | 118.179 |
| MDL Number | MFCD00014936 |
| SMILES | CC1=CC=CC=C1C=C |
| Synonym | 2-methylstyrene,2-vinyltoluene,o-vinyltoluene,o-methylstyrene,styrene, o-methyl,1-methyl-2-vinylbenzene,benzene, 1-ethenyl-2-methyl,ortho-methylstyrene,unii-556uo5cl44,1-ethenyl-2-methyl-benzene |
| IUPAC Name | 1-ethenyl-2-methylbenzene |
| InChI Key | NVZWEEGUWXZOKI-UHFFFAOYSA-N |
| Molecular Formula | C9H10 |
Dimethyl cis-stilbene-4,4'-dicarboxylate
CAS: 143130-82-9 Molecular Formula: C18H16O4 Molecular Weight (g/mol): 296.322 MDL Number: MFCD00082669 InChI Key: JOODVYOWCWQPMV-ARJAWSKDSA-N Synonym: dimethyl cis-stilbene-4,4'-dicarboxylate,dimethyl cis-stilbene-4,4/'-dicarboxylate,z-dimethyl 4,4'-ethene-1,2-diyl dibenzoate,z-4,4'-stilbenedicarboxylic acid dimethyl ester,methyl 4-z-2-4-methoxycarbonylphenyl ethenyl benzoate,methyl 4-z-2-4-methoxycarbonyl phenyl ethenyl benzoate PubChem CID: 7556518 IUPAC Name: methyl 4-[(Z)-2-(4-methoxycarbonylphenyl)ethenyl]benzoate SMILES: COC(=O)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)C(=O)OC
| PubChem CID | 7556518 |
|---|---|
| CAS | 143130-82-9 |
| Molecular Weight (g/mol) | 296.322 |
| MDL Number | MFCD00082669 |
| SMILES | COC(=O)C1=CC=C(C=C1)C=CC2=CC=C(C=C2)C(=O)OC |
| Synonym | dimethyl cis-stilbene-4,4'-dicarboxylate,dimethyl cis-stilbene-4,4/'-dicarboxylate,z-dimethyl 4,4'-ethene-1,2-diyl dibenzoate,z-4,4'-stilbenedicarboxylic acid dimethyl ester,methyl 4-z-2-4-methoxycarbonylphenyl ethenyl benzoate,methyl 4-z-2-4-methoxycarbonyl phenyl ethenyl benzoate |
| IUPAC Name | methyl 4-[(Z)-2-(4-methoxycarbonylphenyl)ethenyl]benzoate |
| InChI Key | JOODVYOWCWQPMV-ARJAWSKDSA-N |
| Molecular Formula | C18H16O4 |
4-Vinylbenzoic acid, 98%
CAS: 1075-49-6 Molecular Formula: C9H8O2 Molecular Weight (g/mol): 148.161 MDL Number: MFCD00002569 InChI Key: IRQWEODKXLDORP-UHFFFAOYSA-N Synonym: 4-vinylbenzoic acid,p-vinylbenzoic acid,4-carboxystyrene,benzoic acid, 4-ethenyl,styrene-4-carboxylic acid,4-vinyl-benzoic acid,p-vinyl benzoic acid,4-vinyl benzoic acid,para-vinyl benzoic acid,pubchem12624 PubChem CID: 14098 IUPAC Name: 4-ethenylbenzoic acid SMILES: C=CC1=CC=C(C=C1)C(=O)O
| PubChem CID | 14098 |
|---|---|
| CAS | 1075-49-6 |
| Molecular Weight (g/mol) | 148.161 |
| MDL Number | MFCD00002569 |
| SMILES | C=CC1=CC=C(C=C1)C(=O)O |
| Synonym | 4-vinylbenzoic acid,p-vinylbenzoic acid,4-carboxystyrene,benzoic acid, 4-ethenyl,styrene-4-carboxylic acid,4-vinyl-benzoic acid,p-vinyl benzoic acid,4-vinyl benzoic acid,para-vinyl benzoic acid,pubchem12624 |
| IUPAC Name | 4-ethenylbenzoic acid |
| InChI Key | IRQWEODKXLDORP-UHFFFAOYSA-N |
| Molecular Formula | C9H8O2 |
4-Vinylphenol, min 10% soln. in propylene glycol
CAS: 2628-17-3 Molecular Formula: C8H8O Molecular Weight (g/mol): 120.151 MDL Number: MFCD00017593 InChI Key: FUGYGGDSWSUORM-UHFFFAOYSA-N Synonym: 4-vinylphenol,4-hydroxystyrene,p-vinylphenol,p-hydroxystyrene,phenol, 4-ethenyl,4-vinylphenol, 10 wt.% in propylene glycol,phenol, p-vinyl,unii-oa7v1sm8yl,fema no. 3739,poly 4-hydroxystyrene PubChem CID: 62453 ChEBI: CHEBI:1883 IUPAC Name: 4-ethenylphenol SMILES: C=CC1=CC=C(C=C1)O
| PubChem CID | 62453 |
|---|---|
| CAS | 2628-17-3 |
| Molecular Weight (g/mol) | 120.151 |
| ChEBI | CHEBI:1883 |
| MDL Number | MFCD00017593 |
| SMILES | C=CC1=CC=C(C=C1)O |
| Synonym | 4-vinylphenol,4-hydroxystyrene,p-vinylphenol,p-hydroxystyrene,phenol, 4-ethenyl,4-vinylphenol, 10 wt.% in propylene glycol,phenol, p-vinyl,unii-oa7v1sm8yl,fema no. 3739,poly 4-hydroxystyrene |
| IUPAC Name | 4-ethenylphenol |
| InChI Key | FUGYGGDSWSUORM-UHFFFAOYSA-N |
| Molecular Formula | C8H8O |